Nanjing Winsome Chemical Limited
Product name:(S)-(-)-2-Chloropropionic acid
CAS No:29617-66-1
Appearance:

Colorless transparent liquid

Content:98%
Structure:(S)-(-)-2-Chloropropionic acid
【Back】